C12H16N4O3 — CID 167885756
1-[4-(2-aminopyridine-4-carbonyl)piperazin-1-yl]-2-hydroxyethanone (PubChem CID 167885756) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-[4-(2-aminopyridine-4-carbonyl)piperazin-1-yl]-2-hydroxyethanone.
| Compound Name | 1-[4-(2-aminopyridine-4-carbonyl)piperazin-1-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 167885756 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[4-(2-aminopyridine-4-carbonyl)piperazin-1-yl]-2-hydroxyethanone |
| SMILES | Nc1cc(C(=O)N2CCN(C(=O)CO)CC2)ccn1 |
| InChI | InChI=1S/C12H16N4O3/c13-10-7-9(1-2-14-10)12(19)16-5-3-15(4-6-16)11(18)8-17/h1-2,7,17H,3-6,8H2,(H2,13,14) |
| InChIKey | MGRARBKDXDUEPD-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |