C23H26N4O2S — CID 143426554
2-(C-naphthalen-1-ylsulfonylcarbonimidoyl)-4-N-(piperidin-4-ylmethyl)benzene-1,4-diamine (PubChem CID 143426554) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-(C-naphthalen-1-ylsulfonylcarbonimidoyl)-4-N-(piperidin-4-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-(C-naphthalen-1-ylsulfonylcarbonimidoyl)-4-N-(piperidin-4-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 143426554 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-(C-naphthalen-1-ylsulfonylcarbonimidoyl)-4-N-(piperidin-4-ylmethyl)benzene-1,4-diamine |
| SMILES | [H]/N=C(\c1cc(NCC2CCNCC2)ccc1N)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H26N4O2S/c24-21-9-8-18(27-15-16-10-12-26-13-11-16)14-20(21)23(25)30(28,29)22-7-3-5-17-4-1-2-6-19(17)22/h1-9,14,16,25-27H,10-13,15,24H2/b25-23+ |
| InChIKey | PSQPTHWAZWYPQV-WJTDDFOZSA-N |
| XLogP | 3.63 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|