C17H17N3O2S — CID 147140080
5-(C-naphthalen-1-ylsulfonylcarbonimidoyl)cyclohexa-1,5-diene-1,4-diamine (PubChem CID 147140080) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 5-(C-naphthalen-1-ylsulfonylcarbonimidoyl)cyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 5-(C-naphthalen-1-ylsulfonylcarbonimidoyl)cyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 147140080 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 5-(C-naphthalen-1-ylsulfonylcarbonimidoyl)cyclohexa-1,5-diene-1,4-diamine |
| SMILES | [H]/N=C(\C1=CC(N)=CCC1N)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H17N3O2S/c18-12-8-9-15(19)14(10-12)17(20)23(21,22)16-7-3-5-11-4-1-2-6-13(11)16/h1-8,10,15,20H,9,18-19H2/b20-17+ |
| InChIKey | BRXZRWVIJOLQAX-LVZFUZTISA-N |
| XLogP | 2.09 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|