C31H51N2O3+ — CID 143427790
[(5S,10S,13S)-10,13-dimethyl-16-(1-methylpyrrolidin-1-ium-1-yl)-2-(1,4-oxazepan-4-yl)-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 143427790) has the molecular formula C31H51N2O3+ and a molecular weight of 499.76 g/mol. Its IUPAC name is [(5S,10S,13S)-10,13-dimethyl-16-(1-methylpyrrolidin-1-ium-1-yl)-2-(1,4-oxazepan-4-yl)-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(5S,10S,13S)-10,13-dimethyl-16-(1-methylpyrrolidin-1-ium-1-yl)-2-(1,4-oxazepan-4-yl)-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 143427790 |
| Molecular Formula | C31H51N2O3+ |
| Molecular Weight | 499.76 g/mol |
| Exact Mass | 499.39 |
| IUPAC Name | [(5S,10S,13S)-10,13-dimethyl-16-(1-methylpyrrolidin-1-ium-1-yl)-2-(1,4-oxazepan-4-yl)-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1C([N+]2(C)CCCC2)CC2C3CC[C@H]4C=CC(N5CCCOCC5)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C31H51N2O3/c1-22(34)36-29-28(33(4)16-5-6-17-33)20-27-25-11-9-23-8-10-24(32-14-7-18-35-19-15-32)21-31(23,3)26(25)12-13-30(27,29)2/h8,10,23-29H,5-7,9,11-21H2,1-4H3/q+1/t23-,24?,25?,26?,27?,28?,29?,30+,31+/m1/s1 |
| InChIKey | QBDBXSFBMWTVFB-NYBRLWEYSA-N |
| XLogP | 5.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.76 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|