C27H46N2O2 — CID 143427802
(13S,16R)-10,13-dimethyl-2-morpholin-4-yl-16-pyrrolidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 143427802) has the molecular formula C27H46N2O2 and a molecular weight of 430.68 g/mol. Its IUPAC name is (13S,16R)-10,13-dimethyl-2-morpholin-4-yl-16-pyrrolidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (13S,16R)-10,13-dimethyl-2-morpholin-4-yl-16-pyrrolidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 143427802 |
| Molecular Formula | C27H46N2O2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.36 |
| IUPAC Name | (13S,16R)-10,13-dimethyl-2-morpholin-4-yl-16-pyrrolidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC12CC(N3CCOCC3)CCC1CCC1C2CC[C@@]2(C)C1C[C@@H](N1CCCC1)C2O |
| InChI | InChI=1S/C27H46N2O2/c1-26-10-9-22-21(23(26)17-24(25(26)30)29-11-3-4-12-29)8-6-19-5-7-20(18-27(19,22)2)28-13-15-31-16-14-28/h19-25,30H,3-18H2,1-2H3/t19?,20?,21?,22?,23?,24-,25?,26+,27?/m1/s1 |
| InChIKey | KOPLVRFOHRQKFC-YOWZUDMDSA-N |
| XLogP | 4.17 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |