C24H40N2O2 — CID 88518354
(1S,2S,11R,12S,14S,15R,16S)-2,16-dimethyl-14-(4-methylpiperazin-1-yl)-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol (PubChem CID 88518354) has the molecular formula C24H40N2O2 and a molecular weight of 388.60 g/mol. Its IUPAC name is (1S,2S,11R,12S,14S,15R,16S)-2,16-dimethyl-14-(4-methylpiperazin-1-yl)-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol.
| Compound Name | (1S,2S,11R,12S,14S,15R,16S)-2,16-dimethyl-14-(4-methylpiperazin-1-yl)-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol |
|---|---|
| PubChem CID | 88518354 |
| Molecular Formula | C24H40N2O2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | (1S,2S,11R,12S,14S,15R,16S)-2,16-dimethyl-14-(4-methylpiperazin-1-yl)-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol |
| SMILES | CN1CCN([C@H]2C[C@H]3[C@@H]4CCC5CC6OC6C[C@]5(C)[C@H]4CC[C@]3(C)[C@H]2O)CC1 |
| InChI | InChI=1S/C24H40N2O2/c1-23-7-6-17-16(5-4-15-12-20-21(28-20)14-24(15,17)2)18(23)13-19(22(23)27)26-10-8-25(3)9-11-26/h15-22,27H,4-14H2,1-3H3/t15?,16-,17+,18+,19+,20?,21?,22+,23+,24+/m1/s1 |
| InChIKey | LMLLOBJSZZIGOW-OZFLOSJGSA-N |
| XLogP | 2.99 |
| TPSA | 39.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|