C25H41NO — CID 54488415
1-[(2S,8S,14S,16S)-2,15,16-trimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-14-yl]piperidine (PubChem CID 54488415) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is 1-[(2S,8S,14S,16S)-2,15,16-trimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-14-yl]piperidine.
| Compound Name | 1-[(2S,8S,14S,16S)-2,15,16-trimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-14-yl]piperidine |
|---|---|
| PubChem CID | 54488415 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | 1-[(2S,8S,14S,16S)-2,15,16-trimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-14-yl]piperidine |
| SMILES | CC1[C@@H](N2CCCCC2)CC2C3CC[C@H]4CC5OC5C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H41NO/c1-16-21(26-11-5-4-6-12-26)14-20-18-8-7-17-13-22-23(27-22)15-25(17,3)19(18)9-10-24(16,20)2/h16-23H,4-15H2,1-3H3/t16?,17-,18?,19?,20?,21-,22?,23?,24+,25-/m0/s1 |
| InChIKey | XUAAKMJQMFUSIG-DTPJJMIXSA-N |
| XLogP | 5.51 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|