C23H35NO2 — CID 89371595
(2S,4R,6S,12S,14S,16S)-2,16-dimethyl-14-pyrrolidin-1-yl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-one (PubChem CID 89371595) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (2S,4R,6S,12S,14S,16S)-2,16-dimethyl-14-pyrrolidin-1-yl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-one.
| Compound Name | (2S,4R,6S,12S,14S,16S)-2,16-dimethyl-14-pyrrolidin-1-yl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-one |
|---|---|
| PubChem CID | 89371595 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (2S,4R,6S,12S,14S,16S)-2,16-dimethyl-14-pyrrolidin-1-yl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-one |
| SMILES | C[C@]12C[C@H]3O[C@H]3CC1CCC1C2CC[C@]2(C)C(=O)[C@@H](N3CCCC3)C[C@@H]12 |
| InChI | InChI=1S/C23H35NO2/c1-22-8-7-16-15(6-5-14-11-19-20(26-19)13-23(14,16)2)17(22)12-18(21(22)25)24-9-3-4-10-24/h14-20H,3-13H2,1-2H3/t14?,15?,16?,17-,18-,19-,20+,22-,23-/m0/s1 |
| InChIKey | ZZMJTNMGPPBIOY-PXEIKWGWSA-N |
| XLogP | 4.05 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|