C26H25FN2OS — CID 143429010
[1-(3-fluorophenyl)propylamino]-(3-methylsulfanyl-2-phenylquinolin-4-yl)methanol (PubChem CID 143429010) has the molecular formula C26H25FN2OS and a molecular weight of 432.56 g/mol. Its IUPAC name is [1-(3-fluorophenyl)propylamino]-(3-methylsulfanyl-2-phenylquinolin-4-yl)methanol.
| Compound Name | [1-(3-fluorophenyl)propylamino]-(3-methylsulfanyl-2-phenylquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 143429010 |
| Molecular Formula | C26H25FN2OS |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [1-(3-fluorophenyl)propylamino]-(3-methylsulfanyl-2-phenylquinolin-4-yl)methanol |
| SMILES | CCC(NC(O)c1c(SC)c(-c2ccccc2)nc2ccccc12)c1cccc(F)c1 |
| InChI | InChI=1S/C26H25FN2OS/c1-3-21(18-12-9-13-19(27)16-18)29-26(30)23-20-14-7-8-15-22(20)28-24(25(23)31-2)17-10-5-4-6-11-17/h4-16,21,26,29-30H,3H2,1-2H3 |
| InChIKey | ZQCWIUOXKQEWFO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|