C20H22FN5O3 — CID 143429507
2-(cyclopropylamino)-7-[(2-fluoro-6-methoxyphenyl)methyl]-9-[(E)-3-methoxyprop-2-enyl]purin-8-one (PubChem CID 143429507) has the molecular formula C20H22FN5O3 and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-(cyclopropylamino)-7-[(2-fluoro-6-methoxyphenyl)methyl]-9-[(E)-3-methoxyprop-2-enyl]purin-8-one.
| Compound Name | 2-(cyclopropylamino)-7-[(2-fluoro-6-methoxyphenyl)methyl]-9-[(E)-3-methoxyprop-2-enyl]purin-8-one |
|---|---|
| PubChem CID | 143429507 |
| Molecular Formula | C20H22FN5O3 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-(cyclopropylamino)-7-[(2-fluoro-6-methoxyphenyl)methyl]-9-[(E)-3-methoxyprop-2-enyl]purin-8-one |
| SMILES | CO/C=C/Cn1c(=O)n(Cc2c(F)cccc2OC)c2cnc(NC3CC3)nc21 |
| InChI | InChI=1S/C20H22FN5O3/c1-28-10-4-9-25-18-16(11-22-19(24-18)23-13-7-8-13)26(20(25)27)12-14-15(21)5-3-6-17(14)29-2/h3-6,10-11,13H,7-9,12H2,1-2H3,(H,22,23,24)/b10-4+ |
| InChIKey | QLKFQHSXQHKJMU-ONNFQVAWSA-N |
| XLogP | 2.52 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|