C28H35ClFN7O2 — CID 143430883
2-chloro-4-[4-[[2-(dimethylamino)ethyl-ethylamino]methyl]phenyl]-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 143430883) has the molecular formula C28H35ClFN7O2 and a molecular weight of 556.09 g/mol. Its IUPAC name is 2-chloro-4-[4-[[2-(dimethylamino)ethyl-ethylamino]methyl]phenyl]-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-chloro-4-[4-[[2-(dimethylamino)ethyl-ethylamino]methyl]phenyl]-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 143430883 |
| Molecular Formula | C28H35ClFN7O2 |
| Molecular Weight | 556.09 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 2-chloro-4-[4-[[2-(dimethylamino)ethyl-ethylamino]methyl]phenyl]-6-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | CCN(CCN(C)C)Cc1ccc(-c2cc(Cl)c(O)c(/C=N/Nc3ncc(F)c(N4CCOCC4)n3)c2)cc1 |
| InChI | InChI=1S/C28H35ClFN7O2/c1-4-36(10-9-35(2)3)19-20-5-7-21(8-6-20)22-15-23(26(38)24(29)16-22)17-32-34-28-31-18-25(30)27(33-28)37-11-13-39-14-12-37/h5-8,15-18,38H,4,9-14,19H2,1-3H3,(H,31,33,34)/b32-17+ |
| InChIKey | GJPIDSFZUVDLFR-VTNSRFBWSA-N |
| XLogP | 4.31 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.09 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|