C26H36F2N2 — CID 143431310
3-ethenyl-5-[(7Z,8E,10Z)-7-ethylidene-9-fluorododeca-8,10-dienyl]-1-[(2Z,4E)-4-fluorohexa-2,4-dienyl]-4H-pyridazine (PubChem CID 143431310) has the molecular formula C26H36F2N2 and a molecular weight of 414.58 g/mol. Its IUPAC name is 3-ethenyl-5-[(7Z,8E,10Z)-7-ethylidene-9-fluorododeca-8,10-dienyl]-1-[(2Z,4E)-4-fluorohexa-2,4-dienyl]-4H-pyridazine.
| Compound Name | 3-ethenyl-5-[(7Z,8E,10Z)-7-ethylidene-9-fluorododeca-8,10-dienyl]-1-[(2Z,4E)-4-fluorohexa-2,4-dienyl]-4H-pyridazine |
|---|---|
| PubChem CID | 143431310 |
| Molecular Formula | C26H36F2N2 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 3-ethenyl-5-[(7Z,8E,10Z)-7-ethylidene-9-fluorododeca-8,10-dienyl]-1-[(2Z,4E)-4-fluorohexa-2,4-dienyl]-4H-pyridazine |
| SMILES | C=CC1=NN(C/C=C\C(F)=C/C)C=C(CCCCCCC(=C/C)/C=C(F)\C=C/C)C1 |
| InChI | InChI=1S/C26H36F2N2/c1-5-14-25(28)19-22(6-2)15-11-9-10-12-16-23-20-26(8-4)29-30(21-23)18-13-17-24(27)7-3/h5-8,13-14,17,19,21H,4,9-12,15-16,18,20H2,1-3H3/b14-5-,17-13-,22-6-,24-7+,25-19+ |
| InChIKey | PLCTYIHJSLTJKI-FANXDALXSA-N |
| XLogP | 8.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|