C18H22F3N3 — CID 123274532
5-methyl-N-(3-methyl-2-methylidenepyrazin-1-yl)-7-(trifluoromethyl)deca-5,7,9-trien-2-imine (PubChem CID 123274532) has the molecular formula C18H22F3N3 and a molecular weight of 337.39 g/mol. Its IUPAC name is 5-methyl-N-(3-methyl-2-methylidenepyrazin-1-yl)-7-(trifluoromethyl)deca-5,7,9-trien-2-imine.
| Compound Name | 5-methyl-N-(3-methyl-2-methylidenepyrazin-1-yl)-7-(trifluoromethyl)deca-5,7,9-trien-2-imine |
|---|---|
| PubChem CID | 123274532 |
| Molecular Formula | C18H22F3N3 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 5-methyl-N-(3-methyl-2-methylidenepyrazin-1-yl)-7-(trifluoromethyl)deca-5,7,9-trien-2-imine |
| SMILES | C=CC=C(C=C(C)CCC(C)=NN1C=CN=C(C)C1=C)C(F)(F)F |
| InChI | InChI=1S/C18H22F3N3/c1-6-7-17(18(19,20)21)12-13(2)8-9-14(3)23-24-11-10-22-15(4)16(24)5/h6-7,10-12H,1,5,8-9H2,2-4H3 |
| InChIKey | LHLVQRXZBJAMJC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|