C16H13BrClN5O2 — CID 143434727
(5-bromofuran-2-yl)-[2-[2-(3-chlorophenyl)tetrazol-5-yl]pyrrolidin-1-yl]methanone (PubChem CID 143434727) has the molecular formula C16H13BrClN5O2 and a molecular weight of 422.67 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[2-[2-(3-chlorophenyl)tetrazol-5-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (5-bromofuran-2-yl)-[2-[2-(3-chlorophenyl)tetrazol-5-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 143434727 |
| Molecular Formula | C16H13BrClN5O2 |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | (5-bromofuran-2-yl)-[2-[2-(3-chlorophenyl)tetrazol-5-yl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)o1)N1CCCC1c1nnn(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C16H13BrClN5O2/c17-14-7-6-13(25-14)16(24)22-8-2-5-12(22)15-19-21-23(20-15)11-4-1-3-10(18)9-11/h1,3-4,6-7,9,12H,2,5,8H2 |
| InChIKey | VWAGLWPZARXEBX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |