C29H37F3O3 — CID 143435758
butane;4-[4-[5-[(1E)-3-hydroxybuta-1,3-dienyl]-2-(trifluoromethoxy)phenyl]-2,5-dimethylphenyl]-4-methylpentan-2-one (PubChem CID 143435758) has the molecular formula C29H37F3O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is butane;4-[4-[5-[(1E)-3-hydroxybuta-1,3-dienyl]-2-(trifluoromethoxy)phenyl]-2,5-dimethylphenyl]-4-methylpentan-2-one.
| Compound Name | butane;4-[4-[5-[(1E)-3-hydroxybuta-1,3-dienyl]-2-(trifluoromethoxy)phenyl]-2,5-dimethylphenyl]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 143435758 |
| Molecular Formula | C29H37F3O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | butane;4-[4-[5-[(1E)-3-hydroxybuta-1,3-dienyl]-2-(trifluoromethoxy)phenyl]-2,5-dimethylphenyl]-4-methylpentan-2-one |
| SMILES | C=C(O)/C=C/c1ccc(OC(F)(F)F)c(-c2cc(C)c(C(C)(C)CC(C)=O)cc2C)c1.CCCC |
| InChI | InChI=1S/C25H27F3O3.C4H10/c1-15-12-22(24(5,6)14-18(4)30)16(2)11-20(15)21-13-19(8-7-17(3)29)9-10-23(21)31-25(26,27)28;1-3-4-2/h7-13,29H,3,14H2,1-2,4-6H3;3-4H2,1-2H3/b8-7+; |
| InChIKey | YZRISACUDPTUAG-USRGLUTNSA-N |
| XLogP | 9.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|