About (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine
(Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine (PubChem CID 143436133) has the molecular formula C19H39NO
and a molecular weight of 297.53 g/mol. Its IUPAC name is (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine.
Molecular Properties
| Compound Name | (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine |
| PubChem CID | 143436133 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine |
| SMILES | C/C=C\C.C=CCC1(CCN)CCOC(C)(CC)C1.CC |
| InChI | InChI=1S/C13H25NO.C4H8.C2H6/c1-4-6-13(7-9-14)8-10-15-12(3,5-2)11-13;1-3-4-2;1-2/h4H,1,5-11,14H2,2-3H3;3-4H,1-2H3;1-2H3/b;4-3-; |
| InChIKey | FQBLVNQHKCIHHD-LWFKIUJUSA-N |
| XLogP | 5.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine?
The IUPAC name of (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine (CID 143436133) is (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine.
What is the SMILES notation for (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine?
The canonical SMILES for (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine is C/C=C\C.C=CCC1(CCN)CCOC(C)(CC)C1.CC.
What is the InChIKey of (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine?
The InChIKey is FQBLVNQHKCIHHD-LWFKIUJUSA-N. The full InChI is InChI=1S/C13H25NO.C4H8.C2H6/c1-4-6-13(7-9-14)8-10-15-12(3,5-2)11-13;1-3-4-2;1-2/h4H,1,5-11,14H2,2-3H3;3-4H,1-2H3;1-2H3/b;4-3-;.
What are the key properties of (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine?
(Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine has a molecular weight of 297.53 g/mol, XLogP of 5.49, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;ethane;2-(2-ethyl-2-methyl-4-prop-2-enyloxan-4-yl)ethanamine is sourced from PubChem (CID 143436133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).