C16H28FNO — CID 163757290
2-[4-(4-fluoro-4-methylcyclohex-2-en-1-yl)-2,2-dimethyloxan-4-yl]ethanamine (PubChem CID 163757290) has the molecular formula C16H28FNO and a molecular weight of 269.40 g/mol. Its IUPAC name is 2-[4-(4-fluoro-4-methylcyclohex-2-en-1-yl)-2,2-dimethyloxan-4-yl]ethanamine.
| Compound Name | 2-[4-(4-fluoro-4-methylcyclohex-2-en-1-yl)-2,2-dimethyloxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 163757290 |
| Molecular Formula | C16H28FNO |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | 2-[4-(4-fluoro-4-methylcyclohex-2-en-1-yl)-2,2-dimethyloxan-4-yl]ethanamine |
| SMILES | CC1(F)C=CC(C2(CCN)CCOC(C)(C)C2)CC1 |
| InChI | InChI=1S/C16H28FNO/c1-14(2)12-16(8-10-18,9-11-19-14)13-4-6-15(3,17)7-5-13/h4,6,13H,5,7-12,18H2,1-3H3 |
| InChIKey | LVEDEMSUUBXUOU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|