C22H26N6O — CID 143436235
1-[6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-[(E)-2-phenylethenyl]pyrimidin-4-yl]azepan-4-ol (PubChem CID 143436235) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-[(E)-2-phenylethenyl]pyrimidin-4-yl]azepan-4-ol.
| Compound Name | 1-[6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-[(E)-2-phenylethenyl]pyrimidin-4-yl]azepan-4-ol |
|---|---|
| PubChem CID | 143436235 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-[6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-[(E)-2-phenylethenyl]pyrimidin-4-yl]azepan-4-ol |
| SMILES | Cc1cc(Nc2cc(N3CCCC(O)CC3)nc(/C=C/c3ccccc3)n2)n[nH]1 |
| InChI | InChI=1S/C22H26N6O/c1-16-14-21(27-26-16)24-20-15-22(28-12-5-8-18(29)11-13-28)25-19(23-20)10-9-17-6-3-2-4-7-17/h2-4,6-7,9-10,14-15,18,29H,5,8,11-13H2,1H3,(H2,23,24,25,26,27)/b10-9+ |
| InChIKey | KMIAOARYYUMKFZ-MDZDMXLPSA-N |
| XLogP | 3.77 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |