C22H28N7+ — CID 91155794
6-(4,4-dimethylpiperazin-4-ium-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)-2-(2-phenylethenyl)pyrimidin-4-amine (PubChem CID 91155794) has the molecular formula C22H28N7+ and a molecular weight of 390.52 g/mol. Its IUPAC name is 6-(4,4-dimethylpiperazin-4-ium-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)-2-(2-phenylethenyl)pyrimidin-4-amine.
| Compound Name | 6-(4,4-dimethylpiperazin-4-ium-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)-2-(2-phenylethenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 91155794 |
| Molecular Formula | C22H28N7+ |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 6-(4,4-dimethylpiperazin-4-ium-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)-2-(2-phenylethenyl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2cc(N3CC[N+](C)(C)CC3)nc(C=Cc3ccccc3)n2)n[nH]1 |
| InChI | InChI=1S/C22H28N7/c1-17-15-21(27-26-17)24-20-16-22(28-11-13-29(2,3)14-12-28)25-19(23-20)10-9-18-7-5-4-6-8-18/h4-10,15-16H,11-14H2,1-3H3,(H2,23,24,25,26,27)/q+1 |
| InChIKey | YAFIIPNEIPHQSA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|