C9H12N2 — CID 143436370
5-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydropyrimidine (PubChem CID 143436370) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydropyrimidine.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 143436370 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydropyrimidine |
| SMILES | C=C/C=C\C1=CNC(C)=NC1 |
| InChI | InChI=1S/C9H12N2/c1-3-4-5-9-6-10-8(2)11-7-9/h3-6H,1,7H2,2H3,(H,10,11)/b5-4- |
| InChIKey | QEZGKLMCYPRDLQ-PLNGDYQASA-N |
| XLogP | 1.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|