C6H8FNO — CID 143436396
(3E)-5-amino-3-fluorohexa-1,3,5-trien-2-ol (PubChem CID 143436396) has the molecular formula C6H8FNO and a molecular weight of 129.13 g/mol. Its IUPAC name is (3E)-5-amino-3-fluorohexa-1,3,5-trien-2-ol.
| Compound Name | (3E)-5-amino-3-fluorohexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 143436396 |
| Molecular Formula | C6H8FNO |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | (3E)-5-amino-3-fluorohexa-1,3,5-trien-2-ol |
| SMILES | C=C(N)/C=C(/F)C(=C)O |
| InChI | InChI=1S/C6H8FNO/c1-4(8)3-6(7)5(2)9/h3,9H,1-2,8H2/b6-3+ |
| InChIKey | NGSUSGIDYDFDTF-ZZXKWVIFSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|