C7H8FNO — CID 156715066
5-amino-7-fluorocyclohepta-1,4,6-trien-1-ol (PubChem CID 156715066) has the molecular formula C7H8FNO and a molecular weight of 141.14 g/mol. Its IUPAC name is 5-amino-7-fluorocyclohepta-1,4,6-trien-1-ol.
| Compound Name | 5-amino-7-fluorocyclohepta-1,4,6-trien-1-ol |
|---|---|
| PubChem CID | 156715066 |
| Molecular Formula | C7H8FNO |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 5-amino-7-fluorocyclohepta-1,4,6-trien-1-ol |
| SMILES | NC1=CCC=C(O)C(F)=C1 |
| InChI | InChI=1S/C7H8FNO/c8-6-4-5(9)2-1-3-7(6)10/h2-4,10H,1,9H2 |
| InChIKey | ZMPYRQMCYAWXLH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |