C26H31F6N3O4S — CID 143436748
(2S)-4-methyl-N-[1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-[[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]pentanamide (PubChem CID 143436748) has the molecular formula C26H31F6N3O4S and a molecular weight of 595.61 g/mol. Its IUPAC name is (2S)-4-methyl-N-[1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-[[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]pentanamide.
| Compound Name | (2S)-4-methyl-N-[1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-[[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 143436748 |
| Molecular Formula | C26H31F6N3O4S |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | (2S)-4-methyl-N-[1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-[[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]pentanamide |
| SMILES | CC(C)C[C@H](NC(c1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1)C(F)(F)F)C(=O)NC(C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C26H31F6N3O4S/c1-15(2)13-21(24(37)34-16(3)23(36)33-14-25(27,28)29)35-22(26(30,31)32)19-7-5-17(6-8-19)18-9-11-20(12-10-18)40(4,38)39/h5-12,15-16,21-22,35H,13-14H2,1-4H3,(H,33,36)(H,34,37)/t16?,21-,22?/m0/s1 |
| InChIKey | CTWJSEPHPVJTCC-QJVIICBYSA-N |
| XLogP | 4.55 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |