C33H59NO3 — CID 143436824
(4aR,10S)-14b-amino-10-hydroxy-4a,6a,6b,9,9,12a-hexamethyl-1,2,3,4,5,6,6a,7,8,8a,10,11,12,13-tetradecahydropicene-2-carboxylic acid;ethane (PubChem CID 143436824) has the molecular formula C33H59NO3 and a molecular weight of 517.84 g/mol. Its IUPAC name is (4aR,10S)-14b-amino-10-hydroxy-4a,6a,6b,9,9,12a-hexamethyl-1,2,3,4,5,6,6a,7,8,8a,10,11,12,13-tetradecahydropicene-2-carboxylic acid;ethane.
| Compound Name | (4aR,10S)-14b-amino-10-hydroxy-4a,6a,6b,9,9,12a-hexamethyl-1,2,3,4,5,6,6a,7,8,8a,10,11,12,13-tetradecahydropicene-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 143436824 |
| Molecular Formula | C33H59NO3 |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 517.45 |
| IUPAC Name | (4aR,10S)-14b-amino-10-hydroxy-4a,6a,6b,9,9,12a-hexamethyl-1,2,3,4,5,6,6a,7,8,8a,10,11,12,13-tetradecahydropicene-2-carboxylic acid;ethane |
| SMILES | CC.CC.CC12CC[C@H](O)C(C)(C)C1CCC1(C)C2CC=C2C1(C)CC[C@@]1(C)CCC(C(=O)O)CC21N |
| InChI | InChI=1S/C29H47NO3.2C2H6/c1-24(2)19-10-14-27(5)20(26(19,4)13-11-22(24)31)7-8-21-28(27,6)16-15-25(3)12-9-18(23(32)33)17-29(21,25)30;2*1-2/h8,18-20,22,31H,7,9-17,30H2,1-6H3,(H,32,33);2*1-2H3/t18?,19?,20?,22-,25+,26?,27?,28?,29?;;/m0../s1 |
| InChIKey | VAJZNGJOVUUALK-BBCQRMMQSA-N |
| XLogP | 7.98 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|