C30H50O2 — CID 162965475
8a-(hydroxymethyl)-4,4,6a,6b,11,12a,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,11,12,14,14a-tetradecahydropicen-3-ol (PubChem CID 162965475) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 8a-(hydroxymethyl)-4,4,6a,6b,11,12a,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,11,12,14,14a-tetradecahydropicen-3-ol.
| Compound Name | 8a-(hydroxymethyl)-4,4,6a,6b,11,12a,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,11,12,14,14a-tetradecahydropicen-3-ol |
|---|---|
| PubChem CID | 162965475 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | 8a-(hydroxymethyl)-4,4,6a,6b,11,12a,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,11,12,14,14a-tetradecahydropicen-3-ol |
| SMILES | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2(C)C1 |
| InChI | InChI=1S/C30H50O2/c1-20-10-15-30(19-31)17-16-28(6)23(29(30,7)18-20)9-8-22-26(4)13-12-24(32)25(2,3)21(26)11-14-27(22,28)5/h9,20-22,24,31-32H,8,10-19H2,1-7H3 |
| InChIKey | SGBQNBOEQIZCQO-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|