C30H50O3 — CID 22294541
(3S,4aR,6aR,6bS,8aR,11R,12aS,14aR,14bR)-8a,11-bis(hydroxymethyl)-4,4,6a,6b,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-ol (PubChem CID 22294541) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is (3S,4aR,6aR,6bS,8aR,11R,12aS,14aR,14bR)-8a,11-bis(hydroxymethyl)-4,4,6a,6b,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-ol.
| Compound Name | (3S,4aR,6aR,6bS,8aR,11R,12aS,14aR,14bR)-8a,11-bis(hydroxymethyl)-4,4,6a,6b,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
|---|---|
| PubChem CID | 22294541 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | (3S,4aR,6aR,6bS,8aR,11R,12aS,14aR,14bR)-8a,11-bis(hydroxymethyl)-4,4,6a,6b,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@](C)(CO)CC[C@]5(CO)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H50O3/c1-25(2)22-9-12-29(6)23(27(22,4)11-10-24(25)33)8-7-20-21-17-26(3,18-31)13-15-30(21,19-32)16-14-28(20,29)5/h7,21-24,31-33H,8-19H2,1-6H3/t21-,22-,23+,24-,26+,27-,28+,29+,30+/m0/s1 |
| InChIKey | XEMGEBCRIGBHSP-FHZOBXGASA-N |
| XLogP | 6.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|