C31H52O — CID 163713869
[(2S,4aS,6aS,6bR,8aS,10S,12aS,14bR)-2,4a,6a,6b,9,9,10,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-2-yl]methanol (PubChem CID 163713869) has the molecular formula C31H52O and a molecular weight of 440.76 g/mol. Its IUPAC name is [(2S,4aS,6aS,6bR,8aS,10S,12aS,14bR)-2,4a,6a,6b,9,9,10,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-2-yl]methanol.
| Compound Name | [(2S,4aS,6aS,6bR,8aS,10S,12aS,14bR)-2,4a,6a,6b,9,9,10,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-2-yl]methanol |
|---|---|
| PubChem CID | 163713869 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | [(2S,4aS,6aS,6bR,8aS,10S,12aS,14bR)-2,4a,6a,6b,9,9,10,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-2-yl]methanol |
| SMILES | C[C@H]1CC[C@]2(C)C3CC=C4[C@@H]5C[C@@](C)(CO)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C31H52O/c1-21-11-13-29(6)24(26(21,2)3)12-14-31(8)25(29)10-9-22-23-19-27(4,20-32)15-16-28(23,5)17-18-30(22,31)7/h9,21,23-25,32H,10-20H2,1-8H3/t21-,23-,24-,25?,27-,28+,29-,30+,31+/m0/s1 |
| InChIKey | JKYWMBXVWAKXHZ-MAKGMCEXSA-N |
| XLogP | 8.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|