C31H52O2 — CID 21136301
2,2,4a,6a,6b,9,9,10,12a-nonamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,4-diol (PubChem CID 21136301) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is 2,2,4a,6a,6b,9,9,10,12a-nonamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,4-diol.
| Compound Name | 2,2,4a,6a,6b,9,9,10,12a-nonamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,4-diol |
|---|---|
| PubChem CID | 21136301 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | 2,2,4a,6a,6b,9,9,10,12a-nonamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,4-diol |
| SMILES | CC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)C(O)C(O)C4(C)CCC23C)C1(C)C |
| InChI | InChI=1S/C31H52O2/c1-19-12-14-29(7)22(27(19,4)5)13-15-31(9)23(29)11-10-20-21-18-26(2,3)24(32)25(33)28(21,6)16-17-30(20,31)8/h10,19,21-25,32-33H,11-18H2,1-9H3 |
| InChIKey | PIXNAIKXQGKOGG-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|