C33H56 — CID 21136302
3,4,4,6a,6b,8a,9,10,11,11,14b-undecamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene (PubChem CID 21136302) has the molecular formula C33H56 and a molecular weight of 452.81 g/mol. Its IUPAC name is 3,4,4,6a,6b,8a,9,10,11,11,14b-undecamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene.
| Compound Name | 3,4,4,6a,6b,8a,9,10,11,11,14b-undecamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene |
|---|---|
| PubChem CID | 21136302 |
| Molecular Formula | C33H56 |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 452.44 |
| IUPAC Name | 3,4,4,6a,6b,8a,9,10,11,11,14b-undecamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene |
| SMILES | CC1C(C)C2(C)CCC3(C)C(=CCC4C5(C)CCC(C)C(C)(C)C5CCC43C)C2CC1(C)C |
| InChI | InChI=1S/C33H56/c1-21-14-16-31(9)26(29(21,6)7)15-17-33(11)27(31)13-12-24-25-20-28(4,5)22(2)23(3)30(25,8)18-19-32(24,33)10/h12,21-23,25-27H,13-20H2,1-11H3 |
| InChIKey | HOEMUJTXGSVSEV-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|