C10H14F3N3 — CID 143436998
(1Z)-2-ethenyl-3-N-methyl-1-(methylideneamino)-1-N-(2,2,2-trifluoroethyl)buta-1,3-diene-1,3-diamine (PubChem CID 143436998) has the molecular formula C10H14F3N3 and a molecular weight of 233.24 g/mol. Its IUPAC name is (1Z)-2-ethenyl-3-N-methyl-1-(methylideneamino)-1-N-(2,2,2-trifluoroethyl)buta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-2-ethenyl-3-N-methyl-1-(methylideneamino)-1-N-(2,2,2-trifluoroethyl)buta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 143436998 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (1Z)-2-ethenyl-3-N-methyl-1-(methylideneamino)-1-N-(2,2,2-trifluoroethyl)buta-1,3-diene-1,3-diamine |
| SMILES | C=C/C(C(=C)NC)=C(/N=C)NCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3/c1-5-8(7(2)14-3)9(15-4)16-6-10(11,12)13/h5,14,16H,1-2,4,6H2,3H3/b9-8+ |
| InChIKey | PPMOPXYWDMHXPH-CMDGGOBGSA-N |
| XLogP | 1.97 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|