C8H12F3N3 — CID 145422882
(1Z)-3-methyl-2-(methylideneamino)-1-N'-(2,2,2-trifluoroethyl)buta-1,3-diene-1,1-diamine (PubChem CID 145422882) has the molecular formula C8H12F3N3 and a molecular weight of 207.20 g/mol. Its IUPAC name is (1Z)-3-methyl-2-(methylideneamino)-1-N'-(2,2,2-trifluoroethyl)buta-1,3-diene-1,1-diamine.
| Compound Name | (1Z)-3-methyl-2-(methylideneamino)-1-N'-(2,2,2-trifluoroethyl)buta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 145422882 |
| Molecular Formula | C8H12F3N3 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (1Z)-3-methyl-2-(methylideneamino)-1-N'-(2,2,2-trifluoroethyl)buta-1,3-diene-1,1-diamine |
| SMILES | C=N/C(C(=C)C)=C(/N)NCC(F)(F)F |
| InChI | InChI=1S/C8H12F3N3/c1-5(2)6(13-3)7(12)14-4-8(9,10)11/h14H,1,3-4,12H2,2H3/b7-6- |
| InChIKey | IOGWQDWLPBPPQJ-SREVYHEPSA-N |
| XLogP | 1.54 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|