C9H13F3N2 — CID 142501227
(1Z,3Z)-3-methyl-1-(methylideneamino)-N-(2,2,2-trifluoroethyl)penta-1,3-dien-1-amine (PubChem CID 142501227) has the molecular formula C9H13F3N2 and a molecular weight of 206.21 g/mol. Its IUPAC name is (1Z,3Z)-3-methyl-1-(methylideneamino)-N-(2,2,2-trifluoroethyl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-3-methyl-1-(methylideneamino)-N-(2,2,2-trifluoroethyl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142501227 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | (1Z,3Z)-3-methyl-1-(methylideneamino)-N-(2,2,2-trifluoroethyl)penta-1,3-dien-1-amine |
| SMILES | C=N/C(=C\C(C)=C/C)NCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2/c1-4-7(2)5-8(13-3)14-6-9(10,11)12/h4-5,14H,3,6H2,1-2H3/b7-4-,8-5+ |
| InChIKey | FPSPPKQVTWNGKZ-DKBJKEKUSA-N |
| XLogP | 2.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|