C20H26N4O2 — CID 143438333
ethane;4-[3-(4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]-N'-methylbenzenecarboximidamide (PubChem CID 143438333) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is ethane;4-[3-(4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]-N'-methylbenzenecarboximidamide.
| Compound Name | ethane;4-[3-(4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143438333 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | ethane;4-[3-(4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1ccc(-c2nc(-c3ccc(O)cc3)no2)cc1.CC.CC |
| InChI | InChI=1S/C16H14N4O2.2C2H6/c1-18-14(17)10-2-4-12(5-3-10)16-19-15(20-22-16)11-6-8-13(21)9-7-11;2*1-2/h2-9,21H,1H3,(H2,17,18);2*1-2H3 |
| InChIKey | GHOFPUJMGKSCBP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|