C17H18ClN3O3 — CID 155538089
4-[3-[4-(3-aminopropoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenol;hydrochloride (PubChem CID 155538089) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 4-[3-[4-(3-aminopropoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenol;hydrochloride.
| Compound Name | 4-[3-[4-(3-aminopropoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 155538089 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-[3-[4-(3-aminopropoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenol;hydrochloride |
| SMILES | Cl.NCCCOc1ccc(-c2noc(-c3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C17H17N3O3.ClH/c18-10-1-11-22-15-8-4-12(5-9-15)16-19-17(23-20-16)13-2-6-14(21)7-3-13;/h2-9,21H,1,10-11,18H2;1H |
| InChIKey | NNPOZEHBVUMUJL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|