C11H14ClN5O — CID 170905342
3-[4-(1,2,4,5-tetrazin-3-yl)phenoxy]propan-1-amine;hydrochloride (PubChem CID 170905342) has the molecular formula C11H14ClN5O and a molecular weight of 267.72 g/mol. Its IUPAC name is 3-[4-(1,2,4,5-tetrazin-3-yl)phenoxy]propan-1-amine;hydrochloride.
| Compound Name | 3-[4-(1,2,4,5-tetrazin-3-yl)phenoxy]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 170905342 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-[4-(1,2,4,5-tetrazin-3-yl)phenoxy]propan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOc1ccc(-c2nncnn2)cc1 |
| InChI | InChI=1S/C11H13N5O.ClH/c12-6-1-7-17-10-4-2-9(3-5-10)11-15-13-8-14-16-11;/h2-5,8H,1,6-7,12H2;1H |
| InChIKey | BGHGMYFBDCVUML-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|