C11H11FN4O — CID 165154581
3-[4-(2-(18F)fluoroethoxymethyl)phenyl]-1,2,4,5-tetrazine (PubChem CID 165154581) has the molecular formula C11H11FN4O and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-[4-(2-(18F)fluoroethoxymethyl)phenyl]-1,2,4,5-tetrazine.
| Compound Name | 3-[4-(2-(18F)fluoroethoxymethyl)phenyl]-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 165154581 |
| Molecular Formula | C11H11FN4O |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-[4-(2-(18F)fluoroethoxymethyl)phenyl]-1,2,4,5-tetrazine |
| SMILES | [18F]CCOCc1ccc(-c2nncnn2)cc1 |
| InChI | InChI=1S/C11H11FN4O/c12-5-6-17-7-9-1-3-10(4-2-9)11-15-13-8-14-16-11/h1-4,8H,5-7H2/i12-1 |
| InChIKey | SEZMXDQBFIRSIP-DWSYCVKZSA-N |
| XLogP | 1.42 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|