C11H13N5O — CID 170855917
N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methoxy]methanamine (PubChem CID 170855917) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methoxy]methanamine.
| Compound Name | N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methoxy]methanamine |
|---|---|
| PubChem CID | 170855917 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methoxy]methanamine |
| SMILES | CNOCc1ccc(-c2nnc(C)nn2)cc1 |
| InChI | InChI=1S/C11H13N5O/c1-8-13-15-11(16-14-8)10-5-3-9(4-6-10)7-17-12-2/h3-6,12H,7H2,1-2H3 |
| InChIKey | YOJPSBRHSNQHNE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|