C10H9N5O — CID 121370392
4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzamide (PubChem CID 121370392) has the molecular formula C10H9N5O and a molecular weight of 215.22 g/mol. Its IUPAC name is 4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzamide.
| Compound Name | 4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzamide |
|---|---|
| PubChem CID | 121370392 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzamide |
| SMILES | Cc1nnc(-c2ccc(C(N)=O)cc2)nn1 |
| InChI | InChI=1S/C10H9N5O/c1-6-12-14-10(15-13-6)8-4-2-7(3-5-8)9(11)16/h2-5H,1H3,(H2,11,16) |
| InChIKey | HTMVBTYJLUWJTQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |