C17H22ClFN2O3 — CID 146619261
4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-2-propan-2-yl-3H-pyridazin-3-ol (PubChem CID 146619261) has the molecular formula C17H22ClFN2O3 and a molecular weight of 356.83 g/mol. Its IUPAC name is 4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-2-propan-2-yl-3H-pyridazin-3-ol.
| Compound Name | 4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-2-propan-2-yl-3H-pyridazin-3-ol |
|---|---|
| PubChem CID | 146619261 |
| Molecular Formula | C17H22ClFN2O3 |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-2-propan-2-yl-3H-pyridazin-3-ol |
| SMILES | CC(C)N1N=CC(OCc2ccc(COCCF)cc2)=C(Cl)C1O |
| InChI | InChI=1S/C17H22ClFN2O3/c1-12(2)21-17(22)16(18)15(9-20-21)24-11-14-5-3-13(4-6-14)10-23-8-7-19/h3-6,9,12,17,22H,7-8,10-11H2,1-2H3 |
| InChIKey | DBBCTTJGOUHUHA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|