C24H28ClFN2O2 — CID 154603926
2-tert-butyl-4-chloro-5-[[4-[4-(3-fluoropropoxy)phenyl]phenyl]methoxy]-3H-pyridazine (PubChem CID 154603926) has the molecular formula C24H28ClFN2O2 and a molecular weight of 430.95 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[4-[4-(3-fluoropropoxy)phenyl]phenyl]methoxy]-3H-pyridazine.
| Compound Name | 2-tert-butyl-4-chloro-5-[[4-[4-(3-fluoropropoxy)phenyl]phenyl]methoxy]-3H-pyridazine |
|---|---|
| PubChem CID | 154603926 |
| Molecular Formula | C24H28ClFN2O2 |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[4-[4-(3-fluoropropoxy)phenyl]phenyl]methoxy]-3H-pyridazine |
| SMILES | CC(C)(C)N1CC(Cl)=C(OCc2ccc(-c3ccc(OCCCF)cc3)cc2)C=N1 |
| InChI | InChI=1S/C24H28ClFN2O2/c1-24(2,3)28-16-22(25)23(15-27-28)30-17-18-5-7-19(8-6-18)20-9-11-21(12-10-20)29-14-4-13-26/h5-12,15H,4,13-14,16-17H2,1-3H3 |
| InChIKey | TWMSZNAAUSKHFG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|