C20H27ClFN3O — CID 139564380
1-tert-butyl-5-chloro-4-[[6-(5-fluoropentyl)-3-pyridinyl]methoxy]-6-methylidenepyridazine (PubChem CID 139564380) has the molecular formula C20H27ClFN3O and a molecular weight of 379.91 g/mol. Its IUPAC name is 1-tert-butyl-5-chloro-4-[[6-(5-fluoropentyl)-3-pyridinyl]methoxy]-6-methylidenepyridazine.
| Compound Name | 1-tert-butyl-5-chloro-4-[[6-(5-fluoropentyl)-3-pyridinyl]methoxy]-6-methylidenepyridazine |
|---|---|
| PubChem CID | 139564380 |
| Molecular Formula | C20H27ClFN3O |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-tert-butyl-5-chloro-4-[[6-(5-fluoropentyl)-3-pyridinyl]methoxy]-6-methylidenepyridazine |
| SMILES | C=C1C(Cl)=C(OCc2ccc(CCCCCF)nc2)C=NN1C(C)(C)C |
| InChI | InChI=1S/C20H27ClFN3O/c1-15-19(21)18(13-24-25(15)20(2,3)4)26-14-16-9-10-17(23-12-16)8-6-5-7-11-22/h9-10,12-13H,1,5-8,11,14H2,2-4H3 |
| InChIKey | DVIWFGHJOFDCCI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|