C19H21FN2O — CID 155197803
N-[4-[4-(2-fluoroethoxymethyl)phenyl]but-3-yn-2-yl]-3-methylpyridin-2-amine (PubChem CID 155197803) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[4-[4-(2-fluoroethoxymethyl)phenyl]but-3-yn-2-yl]-3-methylpyridin-2-amine.
| Compound Name | N-[4-[4-(2-fluoroethoxymethyl)phenyl]but-3-yn-2-yl]-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 155197803 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-[4-[4-(2-fluoroethoxymethyl)phenyl]but-3-yn-2-yl]-3-methylpyridin-2-amine |
| SMILES | Cc1cccnc1NC(C)C#Cc1ccc(COCCF)cc1 |
| InChI | InChI=1S/C19H21FN2O/c1-15-4-3-12-21-19(15)22-16(2)5-6-17-7-9-18(10-8-17)14-23-13-11-20/h3-4,7-10,12,16H,11,13-14H2,1-2H3,(H,21,22) |
| InChIKey | YHINLGBZODLPBI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|