C18H24ClFN2O3 — CID 118223526
2-tert-butyl-4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-1,4-dihydropyridazin-3-one (PubChem CID 118223526) has the molecular formula C18H24ClFN2O3 and a molecular weight of 370.85 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-1,4-dihydropyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-1,4-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 118223526 |
| Molecular Formula | C18H24ClFN2O3 |
| Molecular Weight | 370.85 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-1,4-dihydropyridazin-3-one |
| SMILES | CC(C)(C)N1NC=C(OCc2ccc(COCCF)cc2)C(Cl)C1=O |
| InChI | InChI=1S/C18H24ClFN2O3/c1-18(2,3)22-17(23)16(19)15(10-21-22)25-12-14-6-4-13(5-7-14)11-24-9-8-20/h4-7,10,16,21H,8-9,11-12H2,1-3H3 |
| InChIKey | NYSOAVUPORPPMU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|