C20H19F4N3O3 — CID 137371328
2-[[4-[5-[4-(2-fluoroethoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]ethanamine (PubChem CID 137371328) has the molecular formula C20H19F4N3O3 and a molecular weight of 425.38 g/mol. Its IUPAC name is 2-[[4-[5-[4-(2-fluoroethoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]ethanamine.
| Compound Name | 2-[[4-[5-[4-(2-fluoroethoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]ethanamine |
|---|---|
| PubChem CID | 137371328 |
| Molecular Formula | C20H19F4N3O3 |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[[4-[5-[4-(2-fluoroethoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]ethanamine |
| SMILES | NCCOCc1ccc(-c2noc(-c3ccc(OCCF)c(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C20H19F4N3O3/c21-7-9-29-17-6-5-15(11-16(17)20(22,23)24)19-26-18(27-30-19)14-3-1-13(2-4-14)12-28-10-8-25/h1-6,11H,7-10,12,25H2 |
| InChIKey | VFOAQWMOOIYZAA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|