C25H20F3N5O5S — CID 137370308
2-[4-[3-[4-(azidomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-(trifluoromethyl)phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 137370308) has the molecular formula C25H20F3N5O5S and a molecular weight of 559.53 g/mol. Its IUPAC name is 2-[4-[3-[4-(azidomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-(trifluoromethyl)phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[3-[4-(azidomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-(trifluoromethyl)phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 137370308 |
| Molecular Formula | C25H20F3N5O5S |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 2-[4-[3-[4-(azidomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-(trifluoromethyl)phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(-c3nc(-c4ccc(CN=[N+]=[N-])cc4)no3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H20F3N5O5S/c1-16-2-9-20(10-3-16)39(34,35)37-13-12-36-22-11-8-19(14-21(22)25(26,27)28)24-31-23(32-38-24)18-6-4-17(5-7-18)15-30-33-29/h2-11,14H,12-13,15H2,1H3 |
| InChIKey | NUHHKKQNHWXWIK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 140.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|