C19H16F4N2O3 — CID 137385043
[4-[5-[4-(3-fluoropropoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanol (PubChem CID 137385043) has the molecular formula C19H16F4N2O3 and a molecular weight of 396.34 g/mol. Its IUPAC name is [4-[5-[4-(3-fluoropropoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanol.
| Compound Name | [4-[5-[4-(3-fluoropropoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 137385043 |
| Molecular Formula | C19H16F4N2O3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [4-[5-[4-(3-fluoropropoxy)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanol |
| SMILES | OCc1ccc(-c2noc(-c3ccc(OCCCF)c(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C19H16F4N2O3/c20-8-1-9-27-16-7-6-14(10-15(16)19(21,22)23)18-24-17(25-28-18)13-4-2-12(11-26)3-5-13/h2-7,10,26H,1,8-9,11H2 |
| InChIKey | GJCUQZBZLIWKFF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|