About N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane
N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane (PubChem CID 143439859) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane.
Molecular Properties
| Compound Name | N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane |
| PubChem CID | 143439859 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane |
| SMILES | CC.CNC(=O)C1(NC)CCN(C)CC1 |
| InChI | InChI=1S/C9H19N3O.C2H6/c1-10-8(13)9(11-2)4-6-12(3)7-5-9;1-2/h11H,4-7H2,1-3H3,(H,10,13);1-2H3 |
| InChIKey | ATPRHRAEXOYWQT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane?
The IUPAC name of N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane (CID 143439859) is N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane.
What is the SMILES notation for N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane?
The canonical SMILES for N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane is CC.CNC(=O)C1(NC)CCN(C)CC1.
What is the InChIKey of N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane?
The InChIKey is ATPRHRAEXOYWQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O.C2H6/c1-10-8(13)9(11-2)4-6-12(3)7-5-9;1-2/h11H,4-7H2,1-3H3,(H,10,13);1-2H3.
What are the key properties of N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane?
N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane has a molecular weight of 215.34 g/mol, XLogP of 0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dimethyl-4-(methylamino)piperidine-4-carboxamide;ethane is sourced from PubChem (CID 143439859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).