C13H30N2O — CID 156647639
N,1-dimethyl-3-propan-2-ylazetidine-3-carboxamide;ethane (PubChem CID 156647639) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is N,1-dimethyl-3-propan-2-ylazetidine-3-carboxamide;ethane.
| Compound Name | N,1-dimethyl-3-propan-2-ylazetidine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 156647639 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | N,1-dimethyl-3-propan-2-ylazetidine-3-carboxamide;ethane |
| SMILES | CC.CC.CNC(=O)C1(C(C)C)CN(C)C1 |
| InChI | InChI=1S/C9H18N2O.2C2H6/c1-7(2)9(8(12)10-3)5-11(4)6-9;2*1-2/h7H,5-6H2,1-4H3,(H,10,12);2*1-2H3 |
| InChIKey | IVQAVPPLUZIXMO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |