C12H20BrN5 — CID 143440499
N'-[(Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]prop-1-enyl]-N-methylbutane-1,4-diamine (PubChem CID 143440499) has the molecular formula C12H20BrN5 and a molecular weight of 314.23 g/mol. Its IUPAC name is N'-[(Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]prop-1-enyl]-N-methylbutane-1,4-diamine.
| Compound Name | N'-[(Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]prop-1-enyl]-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 143440499 |
| Molecular Formula | C12H20BrN5 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N'-[(Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]prop-1-enyl]-N-methylbutane-1,4-diamine |
| SMILES | C=Nc1c(Br)cnn1/C(=C\C)NCCCCNC |
| InChI | InChI=1S/C12H20BrN5/c1-4-11(16-8-6-5-7-14-2)18-12(15-3)10(13)9-17-18/h4,9,14,16H,3,5-8H2,1-2H3/b11-4- |
| InChIKey | MKRUWZINLNNXAP-WCIBSUBMSA-N |
| XLogP | 2.39 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|