About ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate
ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate (PubChem CID 143440992) has the molecular formula C12H20O3S
and a molecular weight of 244.36 g/mol. Its IUPAC name is ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate.
Molecular Properties
| Compound Name | ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate |
| PubChem CID | 143440992 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate |
| SMILES | C=C(S/C=C\C)C(=O)CC(=O)OCC.CC |
| InChI | InChI=1S/C10H14O3S.C2H6/c1-4-6-14-8(3)9(11)7-10(12)13-5-2;1-2/h4,6H,3,5,7H2,1-2H3;1-2H3/b6-4-; |
| InChIKey | DPFWBBADHQOOCR-YHSAGPEESA-N |
| XLogP | 3.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate?
The IUPAC name of ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate (CID 143440992) is ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate.
What is the SMILES notation for ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate?
The canonical SMILES for ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate is C=C(S/C=C\C)C(=O)CC(=O)OCC.CC.
What is the InChIKey of ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate?
The InChIKey is DPFWBBADHQOOCR-YHSAGPEESA-N. The full InChI is InChI=1S/C10H14O3S.C2H6/c1-4-6-14-8(3)9(11)7-10(12)13-5-2;1-2/h4,6H,3,5,7H2,1-2H3;1-2H3/b6-4-;.
What are the key properties of ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate?
ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate has a molecular weight of 244.36 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 3-oxo-4-[(Z)-prop-1-enyl]sulfanylpent-4-enoate is sourced from PubChem (CID 143440992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).